C27H48O4Si2 — CID 71486242
2-methyl-5-[(Z)-2-methyl-7-trimethylsilyl-3-tri(propan-2-yl)silyloxyhept-5-en-2-yl]oxycyclohexa-2,5-diene-1,4-dione (PubChem CID 71486242) has the molecular formula C27H48O4Si2 and a molecular weight of 492.85 g/mol. Its IUPAC name is 2-methyl-5-[(Z)-2-methyl-7-trimethylsilyl-3-tri(propan-2-yl)silyloxyhept-5-en-2-yl]oxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methyl-5-[(Z)-2-methyl-7-trimethylsilyl-3-tri(propan-2-yl)silyloxyhept-5-en-2-yl]oxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 71486242 |
| Molecular Formula | C27H48O4Si2 |
| Molecular Weight | 492.85 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 2-methyl-5-[(Z)-2-methyl-7-trimethylsilyl-3-tri(propan-2-yl)silyloxyhept-5-en-2-yl]oxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(OC(C)(C)C(C/C=C\C[Si](C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C)=CC1=O |
| InChI | InChI=1S/C27H48O4Si2/c1-19(2)33(20(3)4,21(5)6)31-26(15-13-14-16-32(10,11)12)27(8,9)30-25-18-23(28)22(7)17-24(25)29/h13-14,17-21,26H,15-16H2,1-12H3/b14-13- |
| InChIKey | GXLVJYSIHGZFEJ-YPKPFQOOSA-N |
| XLogP | 7.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.85 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|