About californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one
californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one (PubChem CID 153467685) has the molecular formula C16H25CfO4Si-
and a molecular weight of 560.46 g/mol. Its IUPAC name is californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one.
Molecular Properties
| Compound Name | californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one |
| PubChem CID | 153467685 |
| Molecular Formula | C16H25CfO4Si- |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one |
| SMILES | CO[Si](C)(CCCOC(C)(C)C(=O)c1cc[c-]cc1)OC.[Cf] |
| InChI | InChI=1S/C16H25O4Si.Cf/c1-16(2,15(17)14-10-7-6-8-11-14)20-12-9-13-21(5,18-3)19-4;/h7-8,10-11H,9,12-13H2,1-5H3;/q-1; |
| InChIKey | IWEDGHIDRQKRFW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one?
The IUPAC name of californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one (CID 153467685) is californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one.
What is the SMILES notation for californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one?
The canonical SMILES for californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one is CO[Si](C)(CCCOC(C)(C)C(=O)c1cc[c-]cc1)OC.[Cf].
What is the InChIKey of californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one?
The InChIKey is IWEDGHIDRQKRFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25O4Si.Cf/c1-16(2,15(17)14-10-7-6-8-11-14)20-12-9-13-21(5,18-3)19-4;/h7-8,10-11H,9,12-13H2,1-5H3;/q-1;.
What are the key properties of californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one?
californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one has a molecular weight of 560.46 g/mol, XLogP of 3.22, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for californium;2-[3-[dimethoxy(methyl)silyl]propoxy]-2-methyl-1-phenylpropan-1-one is sourced from PubChem (CID 153467685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).