C16H24O3Si — CID 71486532
2-methyl-5-[(E)-6-trimethylsilylhex-4-enoxy]cyclohexa-2,5-diene-1,4-dione (PubChem CID 71486532) has the molecular formula C16H24O3Si and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-methyl-5-[(E)-6-trimethylsilylhex-4-enoxy]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methyl-5-[(E)-6-trimethylsilylhex-4-enoxy]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 71486532 |
| Molecular Formula | C16H24O3Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-methyl-5-[(E)-6-trimethylsilylhex-4-enoxy]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(OCCC/C=C/C[Si](C)(C)C)=CC1=O |
| InChI | InChI=1S/C16H24O3Si/c1-13-11-15(18)16(12-14(13)17)19-9-7-5-6-8-10-20(2,3)4/h6,8,11-12H,5,7,9-10H2,1-4H3/b8-6+ |
| InChIKey | XHDZFMWUKBNHIV-SOFGYWHQSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|