C15H24O3Si — CID 11778438
[(4E,7E)-6-oxo-4-(trimethylsilylmethylidene)nona-1,7-dien-5-yl] acetate (PubChem CID 11778438) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is [(4E,7E)-6-oxo-4-(trimethylsilylmethylidene)nona-1,7-dien-5-yl] acetate.
| Compound Name | [(4E,7E)-6-oxo-4-(trimethylsilylmethylidene)nona-1,7-dien-5-yl] acetate |
|---|---|
| PubChem CID | 11778438 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(4E,7E)-6-oxo-4-(trimethylsilylmethylidene)nona-1,7-dien-5-yl] acetate |
| SMILES | C=CC/C(=C\[Si](C)(C)C)C(OC(C)=O)C(=O)/C=C/C |
| InChI | InChI=1S/C15H24O3Si/c1-7-9-13(11-19(4,5)6)15(18-12(3)16)14(17)10-8-2/h7-8,10-11,15H,1,9H2,2-6H3/b10-8+,13-11+ |
| InChIKey | CRJBCWXDHCXKJQ-HATNNVTISA-N |
| XLogP | 3.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|