C26H42O4Si — CID 46238043
(2S,4Z)-2-[(1E,4S,6Z,9Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxododeca-1,6,9-trienyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 46238043) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is (2S,4Z)-2-[(1E,4S,6Z,9Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxododeca-1,6,9-trienyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,4Z)-2-[(1E,4S,6Z,9Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxododeca-1,6,9-trienyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 46238043 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (2S,4Z)-2-[(1E,4S,6Z,9Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxododeca-1,6,9-trienyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | CC/C=C\C/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/[C@@H]1C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C26H42O4Si/c1-7-8-9-10-11-15-18-24(30-31(5,6)26(2,3)4)23(27)21-20-22-17-14-12-13-16-19-25(28)29-22/h8-9,11-12,14-15,20-22,24H,7,10,13,16-19H2,1-6H3/b9-8-,14-12-,15-11-,21-20+/t22-,24-/m0/s1 |
| InChIKey | RZCBRWVEEHJKTI-MSRQIDDJSA-N |
| XLogP | 6.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|