C26H50O4Si2 — CID 10917850
[(2R)-pent-4-en-2-yl] (2E,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]nona-2,8-dienoate (PubChem CID 10917850) has the molecular formula C26H50O4Si2 and a molecular weight of 482.85 g/mol. Its IUPAC name is [(2R)-pent-4-en-2-yl] (2E,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]nona-2,8-dienoate.
| Compound Name | [(2R)-pent-4-en-2-yl] (2E,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]nona-2,8-dienoate |
|---|---|
| PubChem CID | 10917850 |
| Molecular Formula | C26H50O4Si2 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | [(2R)-pent-4-en-2-yl] (2E,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]nona-2,8-dienoate |
| SMILES | C=CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C(=O)O[C@H](C)CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O4Si2/c1-14-16-18-22(29-31(10,11)25(4,5)6)23(30-32(12,13)26(7,8)9)19-20-24(27)28-21(3)17-15-2/h14-15,19-23H,1-2,16-18H2,3-13H3/b20-19+/t21-,22+,23-/m1/s1 |
| InChIKey | LWKPKUISXVZXCV-WWDHVYRZSA-N |
| XLogP | 7.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|