C25H46O3Si — CID 11080356
ethyl (2E,8E,10E,13R)-13-[tert-butyl(dimethyl)silyl]oxy-2,10-dimethylpentadeca-2,8,10-trienoate (PubChem CID 11080356) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is ethyl (2E,8E,10E,13R)-13-[tert-butyl(dimethyl)silyl]oxy-2,10-dimethylpentadeca-2,8,10-trienoate.
| Compound Name | ethyl (2E,8E,10E,13R)-13-[tert-butyl(dimethyl)silyl]oxy-2,10-dimethylpentadeca-2,8,10-trienoate |
|---|---|
| PubChem CID | 11080356 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | ethyl (2E,8E,10E,13R)-13-[tert-butyl(dimethyl)silyl]oxy-2,10-dimethylpentadeca-2,8,10-trienoate |
| SMILES | CCOC(=O)/C(C)=C/CCCC/C=C/C(C)=C/C[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O3Si/c1-10-23(28-29(8,9)25(5,6)7)20-19-21(3)17-15-13-12-14-16-18-22(4)24(26)27-11-2/h15,17-19,23H,10-14,16,20H2,1-9H3/b17-15+,21-19+,22-18+/t23-/m1/s1 |
| InChIKey | KCVBMQQORHCQIN-JAAATZCWSA-N |
| XLogP | 7.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|