C20H28O2 — CID 162955527
[(1S,3E,8E)-9-methyl-5-methylidene-2-propan-2-ylidenecyclodeca-3,8-dien-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162955527) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is [(1S,3E,8E)-9-methyl-5-methylidene-2-propan-2-ylidenecyclodeca-3,8-dien-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,3E,8E)-9-methyl-5-methylidene-2-propan-2-ylidenecyclodeca-3,8-dien-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162955527 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | [(1S,3E,8E)-9-methyl-5-methylidene-2-propan-2-ylidenecyclodeca-3,8-dien-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1/C=C/C(=C(C)C)[C@@H](OC(=O)/C(C)=C\C)C/C(C)=C/CC1 |
| InChI | InChI=1S/C20H28O2/c1-7-17(6)20(21)22-19-13-16(5)10-8-9-15(4)11-12-18(19)14(2)3/h7,10-12,19H,4,8-9,13H2,1-3,5-6H3/b12-11+,16-10+,17-7-/t19-/m0/s1 |
| InChIKey | NJVQRDRMNHDCKA-NGHYCLRSSA-N |
| XLogP | 5.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|