C12H16O2 — CID 3085257
(3S)-3-butyl-4,5-dihydro-3H-2-benzofuran-1-one (PubChem CID 3085257) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (3S)-3-butyl-4,5-dihydro-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-butyl-4,5-dihydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 3085257 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (3S)-3-butyl-4,5-dihydro-3H-2-benzofuran-1-one |
| SMILES | CCCC[C@@H]1OC(=O)C2=C1CCC=C2 |
| InChI | InChI=1S/C12H16O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7,11H,2-4,6,8H2,1H3/t11-/m0/s1 |
| InChIKey | ZPIKVDODKLJKIN-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |