C19H28O2 — CID 44566941
(2S)-2-methyl-4-[(1E,11E)-tetradeca-1,11,13-trienyl]-2H-furan-5-one (PubChem CID 44566941) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2S)-2-methyl-4-[(1E,11E)-tetradeca-1,11,13-trienyl]-2H-furan-5-one.
| Compound Name | (2S)-2-methyl-4-[(1E,11E)-tetradeca-1,11,13-trienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 44566941 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (2S)-2-methyl-4-[(1E,11E)-tetradeca-1,11,13-trienyl]-2H-furan-5-one |
| SMILES | C=C/C=C/CCCCCCCC/C=C/C1=C[C@H](C)OC1=O |
| InChI | InChI=1S/C19H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16-17(2)21-19(18)20/h3-5,14-17H,1,6-13H2,2H3/b5-4+,15-14+/t17-/m0/s1 |
| InChIKey | CKNMIUIXUQWTEQ-CFMQPCBMSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|