C25H37NO5 — CID 122214829
tert-butyl N-[(2S,6E,8E,14E)-15-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-5-oxopentadeca-6,8,14-trien-2-yl]carbamate (PubChem CID 122214829) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is tert-butyl N-[(2S,6E,8E,14E)-15-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-5-oxopentadeca-6,8,14-trien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,6E,8E,14E)-15-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-5-oxopentadeca-6,8,14-trien-2-yl]carbamate |
|---|---|
| PubChem CID | 122214829 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | tert-butyl N-[(2S,6E,8E,14E)-15-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-5-oxopentadeca-6,8,14-trien-2-yl]carbamate |
| SMILES | C[C@@H](CCC(=O)/C=C/C=C/CCCC/C=C/C1=C[C@H](C)OC1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H37NO5/c1-19(26-24(29)31-25(3,4)5)16-17-22(27)15-13-11-9-7-6-8-10-12-14-21-18-20(2)30-23(21)28/h9,11-15,18-20H,6-8,10,16-17H2,1-5H3,(H,26,29)/b11-9+,14-12+,15-13+/t19-,20-/m0/s1 |
| InChIKey | SEZZDOJAMQABLW-DVBDYHQXSA-N |
| XLogP | 5.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|