C17H26N2O2 — CID 69227629
tert-butyl N-[4-(1,3-dihydroisoindol-2-yl)butan-2-yl]carbamate (PubChem CID 69227629) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is tert-butyl N-[4-(1,3-dihydroisoindol-2-yl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(1,3-dihydroisoindol-2-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 69227629 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | tert-butyl N-[4-(1,3-dihydroisoindol-2-yl)butan-2-yl]carbamate |
| SMILES | CC(CCN1Cc2ccccc2C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-13(18-16(20)21-17(2,3)4)9-10-19-11-14-7-5-6-8-15(14)12-19/h5-8,13H,9-12H2,1-4H3,(H,18,20) |
| InChIKey | DHTIEOSGYLWSES-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |