C24H42O4Si — CID 11604210
ethyl (2E,6S,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-7-oxotrideca-2,8,10-trienoate (PubChem CID 11604210) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is ethyl (2E,6S,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-7-oxotrideca-2,8,10-trienoate.
| Compound Name | ethyl (2E,6S,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-7-oxotrideca-2,8,10-trienoate |
|---|---|
| PubChem CID | 11604210 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | ethyl (2E,6S,8E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-7-oxotrideca-2,8,10-trienoate |
| SMILES | CCOC(=O)/C(C)=C/CC[C@H](C)C(=O)/C=C/C(C)=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O4Si/c1-10-27-23(26)21(4)15-11-14-20(3)22(25)17-16-19(2)13-12-18-28-29(8,9)24(5,6)7/h13,15-17,20H,10-12,14,18H2,1-9H3/b17-16+,19-13+,21-15+/t20-/m0/s1 |
| InChIKey | ODACRUYDPMUMPU-VSMHCOQSSA-N |
| XLogP | 6.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|