C26H50O3Si — CID 102343988
butyl (2E,4E)-8-ethyl-5-methyl-7-tri(propan-2-yl)silyloxydeca-2,4-dienoate (PubChem CID 102343988) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is butyl (2E,4E)-8-ethyl-5-methyl-7-tri(propan-2-yl)silyloxydeca-2,4-dienoate.
| Compound Name | butyl (2E,4E)-8-ethyl-5-methyl-7-tri(propan-2-yl)silyloxydeca-2,4-dienoate |
|---|---|
| PubChem CID | 102343988 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | butyl (2E,4E)-8-ethyl-5-methyl-7-tri(propan-2-yl)silyloxydeca-2,4-dienoate |
| SMILES | CCCCOC(=O)/C=C/C=C(\C)CC(O[Si](C(C)C)(C(C)C)C(C)C)C(CC)CC |
| InChI | InChI=1S/C26H50O3Si/c1-11-14-18-28-26(27)17-15-16-23(10)19-25(24(12-2)13-3)29-30(20(4)5,21(6)7)22(8)9/h15-17,20-22,24-25H,11-14,18-19H2,1-10H3/b17-15+,23-16+ |
| InChIKey | PDJNCXSTEPQHMW-XYKMIDAESA-N |
| XLogP | 8.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|