C25H44O3Si — CID 11729487
methyl (2E,4E,8E,10E,14S)-8,14-dimethyl-7-triethylsilyloxyhexadeca-2,4,8,10-tetraenoate (PubChem CID 11729487) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is methyl (2E,4E,8E,10E,14S)-8,14-dimethyl-7-triethylsilyloxyhexadeca-2,4,8,10-tetraenoate.
| Compound Name | methyl (2E,4E,8E,10E,14S)-8,14-dimethyl-7-triethylsilyloxyhexadeca-2,4,8,10-tetraenoate |
|---|---|
| PubChem CID | 11729487 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | methyl (2E,4E,8E,10E,14S)-8,14-dimethyl-7-triethylsilyloxyhexadeca-2,4,8,10-tetraenoate |
| SMILES | CC[C@H](C)CC/C=C/C=C(\C)C(C/C=C/C=C/C(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H44O3Si/c1-8-22(5)18-14-12-15-19-23(6)24(28-29(9-2,10-3)11-4)20-16-13-17-21-25(26)27-7/h12-13,15-17,19,21-22,24H,8-11,14,18,20H2,1-7H3/b15-12+,16-13+,21-17+,23-19+/t22-,24?/m0/s1 |
| InChIKey | ZJWHTGSZTYYMNM-UNMBGSDISA-N |
| XLogP | 7.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|