C24H42O3Si — CID 15297449
(2E,4E,7S,8E,10E,14S)-8,14-dimethyl-7-triethylsilyloxyhexadeca-2,4,8,10-tetraenoic acid (PubChem CID 15297449) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (2E,4E,7S,8E,10E,14S)-8,14-dimethyl-7-triethylsilyloxyhexadeca-2,4,8,10-tetraenoic acid.
| Compound Name | (2E,4E,7S,8E,10E,14S)-8,14-dimethyl-7-triethylsilyloxyhexadeca-2,4,8,10-tetraenoic acid |
|---|---|
| PubChem CID | 15297449 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (2E,4E,7S,8E,10E,14S)-8,14-dimethyl-7-triethylsilyloxyhexadeca-2,4,8,10-tetraenoic acid |
| SMILES | CC[C@H](C)CC/C=C/C=C(\C)[C@H](C/C=C/C=C/C(=O)O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H42O3Si/c1-7-21(5)17-13-11-14-18-22(6)23(19-15-12-16-20-24(25)26)27-28(8-2,9-3)10-4/h11-12,14-16,18,20-21,23H,7-10,13,17,19H2,1-6H3,(H,25,26)/b14-11+,15-12+,20-16+,22-18+/t21-,23-/m0/s1 |
| InChIKey | OOADDTILKXZWCN-APWNMUSKSA-N |
| XLogP | 7.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|