C28H42O3 — CID 16760134
(3Z,4E,6S,8E,12E,14Z,17R,18Z)-3-ethylidene-17-methoxy-6,18,21-trimethyldocosa-4,8,12,14,18,20-hexaenoic acid (PubChem CID 16760134) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (3Z,4E,6S,8E,12E,14Z,17R,18Z)-3-ethylidene-17-methoxy-6,18,21-trimethyldocosa-4,8,12,14,18,20-hexaenoic acid.
| Compound Name | (3Z,4E,6S,8E,12E,14Z,17R,18Z)-3-ethylidene-17-methoxy-6,18,21-trimethyldocosa-4,8,12,14,18,20-hexaenoic acid |
|---|---|
| PubChem CID | 16760134 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (3Z,4E,6S,8E,12E,14Z,17R,18Z)-3-ethylidene-17-methoxy-6,18,21-trimethyldocosa-4,8,12,14,18,20-hexaenoic acid |
| SMILES | C/C=C(\C=C\[C@@H](C)C/C=C/CC/C=C/C=C\C[C@@H](OC)/C(C)=C\C=C(C)C)CC(=O)O |
| InChI | InChI=1S/C28H42O3/c1-7-26(22-28(29)30)21-19-24(4)16-14-12-10-8-9-11-13-15-17-27(31-6)25(5)20-18-23(2)3/h7,9,11-15,18-21,24,27H,8,10,16-17,22H2,1-6H3,(H,29,30)/b11-9+,14-12+,15-13-,21-19+,25-20-,26-7+/t24-,27+/m0/s1 |
| InChIKey | LLILOASKTOZIGL-OKHFSDNLSA-N |
| XLogP | 7.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|