C20H32O2 — CID 10902803
methyl (2E,4E,7R,8E,10E,14R)-7,9,14-trimethylhexadeca-2,4,8,10-tetraenoate (PubChem CID 10902803) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is methyl (2E,4E,7R,8E,10E,14R)-7,9,14-trimethylhexadeca-2,4,8,10-tetraenoate.
| Compound Name | methyl (2E,4E,7R,8E,10E,14R)-7,9,14-trimethylhexadeca-2,4,8,10-tetraenoate |
|---|---|
| PubChem CID | 10902803 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | methyl (2E,4E,7R,8E,10E,14R)-7,9,14-trimethylhexadeca-2,4,8,10-tetraenoate |
| SMILES | CC[C@@H](C)CC/C=C/C(C)=C/[C@H](C)C/C=C/C=C/C(=O)OC |
| InChI | InChI=1S/C20H32O2/c1-6-17(2)12-10-11-14-19(4)16-18(3)13-8-7-9-15-20(21)22-5/h7-9,11,14-18H,6,10,12-13H2,1-5H3/b8-7+,14-11+,15-9+,19-16+/t17-,18-/m1/s1 |
| InChIKey | KDIKGBSGQLBRQP-LACIPOBDSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|