C19H30O2 — CID 11808426
ethyl (2E,4E,6E,8E,10S,12S)-8,10,12-trimethyltetradeca-2,4,6,8-tetraenoate (PubChem CID 11808426) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10S,12S)-8,10,12-trimethyltetradeca-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10S,12S)-8,10,12-trimethyltetradeca-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 11808426 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10S,12S)-8,10,12-trimethyltetradeca-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/C(C)=C/[C@@H](C)C[C@@H](C)CC |
| InChI | InChI=1S/C19H30O2/c1-6-16(3)14-18(5)15-17(4)12-10-8-9-11-13-19(20)21-7-2/h8-13,15-16,18H,6-7,14H2,1-5H3/b9-8+,12-10+,13-11+,17-15+/t16-,18-/m0/s1 |
| InChIKey | DLZPKYBATIJMFR-NGSPYLCSSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|