C20H30O4 — CID 88857370
1-O-ethyl 13-O-methyl (2E,4E,6E,8R,9S,11Z)-6,8,9,12-tetramethyltrideca-2,4,6,11-tetraenedioate (PubChem CID 88857370) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-O-ethyl 13-O-methyl (2E,4E,6E,8R,9S,11Z)-6,8,9,12-tetramethyltrideca-2,4,6,11-tetraenedioate.
| Compound Name | 1-O-ethyl 13-O-methyl (2E,4E,6E,8R,9S,11Z)-6,8,9,12-tetramethyltrideca-2,4,6,11-tetraenedioate |
|---|---|
| PubChem CID | 88857370 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-O-ethyl 13-O-methyl (2E,4E,6E,8R,9S,11Z)-6,8,9,12-tetramethyltrideca-2,4,6,11-tetraenedioate |
| SMILES | CCOC(=O)/C=C/C=C/C(C)=C/[C@H](C)[C@@H](C)C/C=C(/C)C(=O)OC |
| InChI | InChI=1S/C20H30O4/c1-7-24-19(21)11-9-8-10-15(2)14-18(5)16(3)12-13-17(4)20(22)23-6/h8-11,13-14,16,18H,7,12H2,1-6H3/b10-8+,11-9+,15-14+,17-13-/t16-,18-/m0/s1 |
| InChIKey | HKVBAMPTYYCWHO-ZYHHYYDDSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|