C12H21I — CID 10913328
(1E,3E,5S,7S)-1-iodo-3,5,7-trimethylnona-1,3-diene (PubChem CID 10913328) has the molecular formula C12H21I and a molecular weight of 292.20 g/mol. Its IUPAC name is (1E,3E,5S,7S)-1-iodo-3,5,7-trimethylnona-1,3-diene.
| Compound Name | (1E,3E,5S,7S)-1-iodo-3,5,7-trimethylnona-1,3-diene |
|---|---|
| PubChem CID | 10913328 |
| Molecular Formula | C12H21I |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (1E,3E,5S,7S)-1-iodo-3,5,7-trimethylnona-1,3-diene |
| SMILES | CC[C@H](C)C[C@H](C)/C=C(C)/C=C/I |
| InChI | InChI=1S/C12H21I/c1-5-10(2)8-12(4)9-11(3)6-7-13/h6-7,9-10,12H,5,8H2,1-4H3/b7-6+,11-9+/t10-,12-/m0/s1 |
| InChIKey | ZTTMJOGXZKKWPC-HRVMZFPISA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|