C27H46O7 — CID 118035484
(2Z,4E)-2-[3-[(3S)-3-carboxy-3-hydroxypropoxy]-2-methyl-3-oxopropyl]-4,6,8,10,12-pentamethyltetradeca-2,4-dienoic acid (PubChem CID 118035484) has the molecular formula C27H46O7 and a molecular weight of 482.66 g/mol. Its IUPAC name is (2Z,4E)-2-[3-[(3S)-3-carboxy-3-hydroxypropoxy]-2-methyl-3-oxopropyl]-4,6,8,10,12-pentamethyltetradeca-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-[3-[(3S)-3-carboxy-3-hydroxypropoxy]-2-methyl-3-oxopropyl]-4,6,8,10,12-pentamethyltetradeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 118035484 |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (2Z,4E)-2-[3-[(3S)-3-carboxy-3-hydroxypropoxy]-2-methyl-3-oxopropyl]-4,6,8,10,12-pentamethyltetradeca-2,4-dienoic acid |
| SMILES | CCC(C)CC(C)CC(C)CC(C)/C=C(C)/C=C(/CC(C)C(=O)OCC[C@H](O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H46O7/c1-8-17(2)11-18(3)12-19(4)13-20(5)14-21(6)15-23(25(29)30)16-22(7)27(33)34-10-9-24(28)26(31)32/h14-15,17-20,22,24,28H,8-13,16H2,1-7H3,(H,29,30)(H,31,32)/b21-14+,23-15-/t17?,18?,19?,20?,22?,24-/m0/s1 |
| InChIKey | RWCUYHPYSSLLBJ-MSNUADCOSA-N |
| XLogP | 5.47 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|