C19H35IO3Si — CID 15384704
tert-butyl (2E,5S,6R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-6-methylocta-2,7-dienoate (PubChem CID 15384704) has the molecular formula C19H35IO3Si and a molecular weight of 466.48 g/mol. Its IUPAC name is tert-butyl (2E,5S,6R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-6-methylocta-2,7-dienoate.
| Compound Name | tert-butyl (2E,5S,6R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-6-methylocta-2,7-dienoate |
|---|---|
| PubChem CID | 15384704 |
| Molecular Formula | C19H35IO3Si |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | tert-butyl (2E,5S,6R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-6-methylocta-2,7-dienoate |
| SMILES | C[C@H](/C=C/I)[C@H](C/C=C/C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H35IO3Si/c1-15(13-14-20)16(23-24(8,9)19(5,6)7)11-10-12-17(21)22-18(2,3)4/h10,12-16H,11H2,1-9H3/b12-10+,14-13+/t15-,16+/m1/s1 |
| InChIKey | SOSLCNBKMNQMSX-LLMNSZGMSA-N |
| XLogP | 6.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|