C34H60O4Si2 — CID 72701906
ethyl (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-14,16-dimethyl-17-triethylsilyloxyoctadeca-2,4,6,8,10,12-hexaenoate (PubChem CID 72701906) has the molecular formula C34H60O4Si2 and a molecular weight of 589.02 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-14,16-dimethyl-17-triethylsilyloxyoctadeca-2,4,6,8,10,12-hexaenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-14,16-dimethyl-17-triethylsilyloxyoctadeca-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 72701906 |
| Molecular Formula | C34H60O4Si2 |
| Molecular Weight | 589.02 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-14,16-dimethyl-17-triethylsilyloxyoctadeca-2,4,6,8,10,12-hexaenoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H60O4Si2/c1-13-36-32(35)28-26-24-22-20-18-17-19-21-23-25-27-29(5)33(38-39(11,12)34(8,9)10)30(6)31(7)37-40(14-2,15-3)16-4/h17-31,33H,13-16H2,1-12H3/b19-17+,20-18+,23-21+,24-22+,27-25+,28-26+/t29-,30-,31-,33+/m0/s1 |
| InChIKey | XWIXKFLMBHJPFU-HNPARKEASA-N |
| XLogP | 9.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.02 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|