C26H46O3Si — CID 134865786
ethyl (2E,4Z,6E,8E,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8,10-pentamethyltrideca-2,4,6,8-tetraenoate (PubChem CID 134865786) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is ethyl (2E,4Z,6E,8E,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8,10-pentamethyltrideca-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4Z,6E,8E,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8,10-pentamethyltrideca-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 134865786 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | ethyl (2E,4Z,6E,8E,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8,10-pentamethyltrideca-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C(C)=C/C(C)=C\C(C)=C\C(C)=C\[C@@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O3Si/c1-13-24(29-30(11,12)26(8,9)10)22(6)17-20(4)15-19(3)16-21(5)18-23(7)25(27)28-14-2/h15-18,22,24H,13-14H2,1-12H3/b19-15+,20-17+,21-16-,23-18+/t22-,24-/m1/s1 |
| InChIKey | FNUPZWBIPNZULC-VHETYOEQSA-N |
| XLogP | 7.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|