C21H36O4Si — CID 166441855
(3Z,6S,8S,9E,11E)-8-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,10-dimethyl-1-oxacyclotrideca-3,9,11-trien-2-one (PubChem CID 166441855) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (3Z,6S,8S,9E,11E)-8-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,10-dimethyl-1-oxacyclotrideca-3,9,11-trien-2-one.
| Compound Name | (3Z,6S,8S,9E,11E)-8-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,10-dimethyl-1-oxacyclotrideca-3,9,11-trien-2-one |
|---|---|
| PubChem CID | 166441855 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (3Z,6S,8S,9E,11E)-8-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,10-dimethyl-1-oxacyclotrideca-3,9,11-trien-2-one |
| SMILES | CO[C@H]1C/C=C(/C)C(=O)OC/C=C/C(C)=C/[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H36O4Si/c1-16-10-9-13-24-20(22)17(2)11-12-18(23-6)15-19(14-16)25-26(7,8)21(3,4)5/h9-11,14,18-19H,12-13,15H2,1-8H3/b10-9+,16-14+,17-11-/t18-,19+/m0/s1 |
| InChIKey | CHUDAXLPROZVGD-BCCLDBCDSA-N |
| XLogP | 5.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|