C25H42O5Si — CID 10983245
methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-8-[(2S,6R)-2-(2-oxobutyl)-3,6-dihydro-2H-pyran-6-yl]octa-2,4-dienoate (PubChem CID 10983245) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-8-[(2S,6R)-2-(2-oxobutyl)-3,6-dihydro-2H-pyran-6-yl]octa-2,4-dienoate.
| Compound Name | methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-8-[(2S,6R)-2-(2-oxobutyl)-3,6-dihydro-2H-pyran-6-yl]octa-2,4-dienoate |
|---|---|
| PubChem CID | 10983245 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-8-[(2S,6R)-2-(2-oxobutyl)-3,6-dihydro-2H-pyran-6-yl]octa-2,4-dienoate |
| SMILES | CCC(=O)C[C@@H]1CC=C[C@@H](C[C@H](C/C=C(C)/C=C/C(=O)OC)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H42O5Si/c1-9-20(26)17-21-11-10-12-22(29-21)18-23(30-31(7,8)25(3,4)5)15-13-19(2)14-16-24(27)28-6/h10,12-14,16,21-23H,9,11,15,17-18H2,1-8H3/b16-14+,19-13+/t21-,22-,23-/m0/s1 |
| InChIKey | FMPRWGTZVSNSNJ-CPLFGAPZSA-N |
| XLogP | 5.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|