C21H36O3Si — CID 134957302
2-[(2S,6R)-6-[(2S,4E)-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhepta-4,6-dienyl]-3,6-dihydro-2H-pyran-2-yl]acetaldehyde (PubChem CID 134957302) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is 2-[(2S,6R)-6-[(2S,4E)-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhepta-4,6-dienyl]-3,6-dihydro-2H-pyran-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,6R)-6-[(2S,4E)-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhepta-4,6-dienyl]-3,6-dihydro-2H-pyran-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 134957302 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-[(2S,6R)-6-[(2S,4E)-2-[tert-butyl(dimethyl)silyl]oxy-5-methylhepta-4,6-dienyl]-3,6-dihydro-2H-pyran-2-yl]acetaldehyde |
| SMILES | C=C/C(C)=C/C[C@@H](C[C@@H]1C=CC[C@@H](CC=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-8-17(2)12-13-20(24-25(6,7)21(3,4)5)16-19-11-9-10-18(23-19)14-15-22/h8-9,11-12,15,18-20H,1,10,13-14,16H2,2-7H3/b17-12+/t18-,19-,20-/m0/s1 |
| InChIKey | JGSXGWUBJOTQFE-DKUUJNHXSA-N |
| XLogP | 5.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|