C30H52O5Si — CID 11016781
[(2E,4E,7S)-4-methyl-8-[(2S,6R)-2-(2-oxoethyl)-3,6-dihydro-2H-pyran-6-yl]-7-tri(propan-2-yl)silyloxyocta-2,4-dienyl] 2,2-dimethylpropanoate (PubChem CID 11016781) has the molecular formula C30H52O5Si and a molecular weight of 520.83 g/mol. Its IUPAC name is [(2E,4E,7S)-4-methyl-8-[(2S,6R)-2-(2-oxoethyl)-3,6-dihydro-2H-pyran-6-yl]-7-tri(propan-2-yl)silyloxyocta-2,4-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E,4E,7S)-4-methyl-8-[(2S,6R)-2-(2-oxoethyl)-3,6-dihydro-2H-pyran-6-yl]-7-tri(propan-2-yl)silyloxyocta-2,4-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11016781 |
| Molecular Formula | C30H52O5Si |
| Molecular Weight | 520.83 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | [(2E,4E,7S)-4-methyl-8-[(2S,6R)-2-(2-oxoethyl)-3,6-dihydro-2H-pyran-6-yl]-7-tri(propan-2-yl)silyloxyocta-2,4-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(/C=C/COC(=O)C(C)(C)C)=C\C[C@@H](C[C@@H]1C=CC[C@@H](CC=O)O1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H52O5Si/c1-22(2)36(23(3)4,24(5)6)35-28(21-27-15-11-14-26(34-27)18-19-31)17-16-25(7)13-12-20-33-29(32)30(8,9)10/h11-13,15-16,19,22-24,26-28H,14,17-18,20-21H2,1-10H3/b13-12+,25-16+/t26-,27-,28-/m0/s1 |
| InChIKey | QIKGRFYCJIZDQE-IEQRHLMWSA-N |
| XLogP | 7.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.83 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|