C18H24O5 — CID 46919541
3-O-[(2S)-hex-5-en-2-yl] 1-O-[(1S)-4-oxo-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl] propanedioate (PubChem CID 46919541) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-O-[(2S)-hex-5-en-2-yl] 1-O-[(1S)-4-oxo-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl] propanedioate.
| Compound Name | 3-O-[(2S)-hex-5-en-2-yl] 1-O-[(1S)-4-oxo-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl] propanedioate |
|---|---|
| PubChem CID | 46919541 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-O-[(2S)-hex-5-en-2-yl] 1-O-[(1S)-4-oxo-3-[(Z)-prop-1-enyl]cyclohex-2-en-1-yl] propanedioate |
| SMILES | C=CCC[C@H](C)OC(=O)CC(=O)O[C@@H]1C=C(/C=C\C)C(=O)CC1 |
| InChI | InChI=1S/C18H24O5/c1-4-6-8-13(3)22-17(20)12-18(21)23-15-9-10-16(19)14(11-15)7-5-2/h4-5,7,11,13,15H,1,6,8-10,12H2,2-3H3/b7-5-/t13-,15-/m0/s1 |
| InChIKey | OQHNCJLKWRZQCZ-FRGQNTEPSA-N |
| XLogP | 3.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|