C21H24O7 — CID 163043932
[(4S,6E,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2,8-dioxo-4,5,9,11a-tetrahydrocyclodeca[b]furan-4-yl] 2-methylprop-2-enoate (PubChem CID 163043932) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is [(4S,6E,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2,8-dioxo-4,5,9,11a-tetrahydrocyclodeca[b]furan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(4S,6E,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2,8-dioxo-4,5,9,11a-tetrahydrocyclodeca[b]furan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163043932 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(4S,6E,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2,8-dioxo-4,5,9,11a-tetrahydrocyclodeca[b]furan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1C/C(C)=C/C(=O)C/C(C)=C/[C@H]2OC(=O)C(COC(C)=O)=C12 |
| InChI | InChI=1S/C21H24O7/c1-11(2)20(24)27-17-8-12(3)6-15(23)7-13(4)9-18-19(17)16(21(25)28-18)10-26-14(5)22/h6,9,17-18H,1,7-8,10H2,2-5H3/b12-6+,13-9+/t17-,18+/m0/s1 |
| InChIKey | SPSGOWUSQPWNFA-XBRAKSBRSA-N |
| XLogP | 2.51 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|