C22H30O6 — CID 162989713
[(6E,9S,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] 3-methylbutanoate (PubChem CID 162989713) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(6E,9S,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] 3-methylbutanoate.
| Compound Name | [(6E,9S,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162989713 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [(6E,9S,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] 3-methylbutanoate |
| SMILES | CC(=O)OCC1=C2CC/C(C)=C/C[C@H](OC(=O)CC(C)C)/C(C)=C/[C@H]2OC1=O |
| InChI | InChI=1S/C22H30O6/c1-13(2)10-21(24)27-19-9-7-14(3)6-8-17-18(12-26-16(5)23)22(25)28-20(17)11-15(19)4/h7,11,13,19-20H,6,8-10,12H2,1-5H3/b14-7+,15-11+/t19-,20+/m0/s1 |
| InChIKey | DGDGNNWGTKTTKN-KWTOUDHNSA-N |
| XLogP | 3.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|