C22H28O6 — CID 643636
[(6E,9S,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] (E)-2-methylbut-2-enoate (PubChem CID 643636) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is [(6E,9S,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(6E,9S,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 643636 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(6E,9S,10E,11aR)-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C/C=C(\C)CCC2=C(COC(C)=O)C(=O)O[C@@H]2/C=C/1C |
| InChI | InChI=1S/C22H28O6/c1-6-14(3)21(24)27-19-10-8-13(2)7-9-17-18(12-26-16(5)23)22(25)28-20(17)11-15(19)4/h6,8,11,19-20H,7,9-10,12H2,1-5H3/b13-8+,14-6+,15-11+/t19-,20+/m0/s1 |
| InChIKey | GLMKCGIRLHWKCY-FKHMABJLSA-N |
| XLogP | 3.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|