C18H28O3 — CID 135066989
methyl 4-[(3E)-deca-1,3-dien-2-yl]-2-ethyl-2,5-dihydrofuran-3-carboxylate (PubChem CID 135066989) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is methyl 4-[(3E)-deca-1,3-dien-2-yl]-2-ethyl-2,5-dihydrofuran-3-carboxylate.
| Compound Name | methyl 4-[(3E)-deca-1,3-dien-2-yl]-2-ethyl-2,5-dihydrofuran-3-carboxylate |
|---|---|
| PubChem CID | 135066989 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | methyl 4-[(3E)-deca-1,3-dien-2-yl]-2-ethyl-2,5-dihydrofuran-3-carboxylate |
| SMILES | C=C(/C=C/CCCCCC)C1=C(C(=O)OC)C(CC)OC1 |
| InChI | InChI=1S/C18H28O3/c1-5-7-8-9-10-11-12-14(3)15-13-21-16(6-2)17(15)18(19)20-4/h11-12,16H,3,5-10,13H2,1-2,4H3/b12-11+ |
| InChIKey | MDLJQFAGJVQDSE-VAWYXSNFSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|