C29H44O5Si — CID 46855130
(1S,2E,5S,8E,10Z,14E,17S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione (PubChem CID 46855130) has the molecular formula C29H44O5Si and a molecular weight of 500.75 g/mol. Its IUPAC name is (1S,2E,5S,8E,10Z,14E,17S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione.
| Compound Name | (1S,2E,5S,8E,10Z,14E,17S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione |
|---|---|
| PubChem CID | 46855130 |
| Molecular Formula | C29H44O5Si |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | (1S,2E,5S,8E,10Z,14E,17S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione |
| SMILES | C=C1C[C@@H]2C/C=C/C(=O)C/C(C)=C\C=C\C(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)C/C(C)=C/[C@H](C1)O2 |
| InChI | InChI=1S/C29H44O5Si/c1-21-11-9-14-28(31)34-27(20-32-35(7,8)29(4,5)6)19-23(3)18-26-17-22(2)16-25(33-26)13-10-12-24(30)15-21/h9-12,14,18,25-27H,2,13,15-17,19-20H2,1,3-8H3/b12-10+,14-9+,21-11-,23-18+/t25-,26-,27-/m0/s1 |
| InChIKey | ZFSOGHFXBIDTKC-YKPVMZTJSA-N |
| XLogP | 6.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|