C17H30O5Si — CID 102146555
methyl (E)-4-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxooxan-2-yl]-3-methylbut-2-enoate (PubChem CID 102146555) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is methyl (E)-4-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxooxan-2-yl]-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxooxan-2-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 102146555 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | methyl (E)-4-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxooxan-2-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)/C=C(\C)C[C@@H]1OCCC(=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O5Si/c1-12(11-15(19)20-5)10-14-16(13(18)8-9-21-14)22-23(6,7)17(2,3)4/h11,14,16H,8-10H2,1-7H3/b12-11+/t14-,16+/m0/s1 |
| InChIKey | DVOYPJBMCOVXJZ-IXVOVUJJSA-N |
| XLogP | 3.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|