C30H54O5Si — CID 10984194
octyl (E)-4-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-hex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoate (PubChem CID 10984194) has the molecular formula C30H54O5Si and a molecular weight of 522.84 g/mol. Its IUPAC name is octyl (E)-4-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-hex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoate.
| Compound Name | octyl (E)-4-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-hex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10984194 |
| Molecular Formula | C30H54O5Si |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | octyl (E)-4-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-hex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoate |
| SMILES | CCC/C=C/C[C@H]1CO[C@@H](C/C(C)=C/C(=O)OCCCCCCCC)[C@H](O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C30H54O5Si/c1-9-11-13-15-16-18-20-33-27(31)22-24(3)21-26-29(35-36(7,8)30(4,5)6)28(32)25(23-34-26)19-17-14-12-10-2/h14,17,22,25-26,29H,9-13,15-16,18-21,23H2,1-8H3/b17-14+,24-22+/t25-,26-,29-/m0/s1 |
| InChIKey | AVCNXEDKZSRXFX-TXVWQBJBSA-N |
| XLogP | 7.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|