C30H56O6Si2 — CID 134940029
methyl (E)-4-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E,4R,5S)-4-methyl-5-triethylsilyloxyhex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoate (PubChem CID 134940029) has the molecular formula C30H56O6Si2 and a molecular weight of 568.94 g/mol. Its IUPAC name is methyl (E)-4-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E,4R,5S)-4-methyl-5-triethylsilyloxyhex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E,4R,5S)-4-methyl-5-triethylsilyloxyhex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 134940029 |
| Molecular Formula | C30H56O6Si2 |
| Molecular Weight | 568.94 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | methyl (E)-4-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E,4R,5S)-4-methyl-5-triethylsilyloxyhex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](C)[C@H](C)/C=C/C[C@H]1CO[C@@H](C/C(C)=C/C(=O)OC)[C@H](O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C30H56O6Si2/c1-13-38(14-2,15-3)35-24(6)23(5)17-16-18-25-21-34-26(19-22(4)20-27(31)33-10)29(28(25)32)36-37(11,12)30(7,8)9/h16-17,20,23-26,29H,13-15,18-19,21H2,1-12H3/b17-16+,22-20+/t23-,24+,25+,26+,29+/m1/s1 |
| InChIKey | YAOSRBQEXYJZGU-OABXQLOFSA-N |
| XLogP | 7.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.94 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|