C17H30O3Si — CID 135068049
(1R,2R,4S,5S)-2-butyl-4-triethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 135068049) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is (1R,2R,4S,5S)-2-butyl-4-triethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2R,4S,5S)-2-butyl-4-triethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 135068049 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (1R,2R,4S,5S)-2-butyl-4-triethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CCCC[C@H]1C(=O)[C@@H](O[Si](CC)(CC)CC)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C17H30O3Si/c1-5-9-10-13-14-11-12-15(19-14)17(16(13)18)20-21(6-2,7-3)8-4/h11-15,17H,5-10H2,1-4H3/t13-,14-,15+,17+/m1/s1 |
| InChIKey | TWRUYUJQSSROEG-AIANPOQGSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|