C31H48O5Si — CID 135073073
[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (2E,4Z,8E)-10-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]-5-methyl-7-oxodeca-2,4,8-trienoate (PubChem CID 135073073) has the molecular formula C31H48O5Si and a molecular weight of 528.81 g/mol. Its IUPAC name is [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (2E,4Z,8E)-10-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]-5-methyl-7-oxodeca-2,4,8-trienoate.
| Compound Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (2E,4Z,8E)-10-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]-5-methyl-7-oxodeca-2,4,8-trienoate |
|---|---|
| PubChem CID | 135073073 |
| Molecular Formula | C31H48O5Si |
| Molecular Weight | 528.81 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-4-en-2-yl] (2E,4Z,8E)-10-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]-5-methyl-7-oxodeca-2,4,8-trienoate |
| SMILES | C=C[C@@H]1CC(=C)C[C@H](C/C=C/C(=O)C/C(C)=C\C=C\C(=O)O[C@@H](CO[Si](C)(C)C(C)(C)C)CC(=C)C)O1 |
| InChI | InChI=1S/C31H48O5Si/c1-11-27-20-25(5)21-28(35-27)16-13-15-26(32)19-24(4)14-12-17-30(33)36-29(18-23(2)3)22-34-37(9,10)31(6,7)8/h11-15,17,27-29H,1-2,5,16,18-22H2,3-4,6-10H3/b15-13+,17-12+,24-14-/t27-,28+,29-/m1/s1 |
| InChIKey | LGBDPGYOCVWKCH-BZPSNHTDSA-N |
| XLogP | 7.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.81 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|