C30H50O6Si2 — CID 138975803
[(3S,4Z,7S,8R,12R)-12-[(Z)-but-2-en-2-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,6-dioxo-5-trimethylsilyl-1-oxacyclododec-4-en-9-yn-7-yl] 3-methylbutanoate (PubChem CID 138975803) has the molecular formula C30H50O6Si2 and a molecular weight of 562.90 g/mol. Its IUPAC name is [(3S,4Z,7S,8R,12R)-12-[(Z)-but-2-en-2-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,6-dioxo-5-trimethylsilyl-1-oxacyclododec-4-en-9-yn-7-yl] 3-methylbutanoate.
| Compound Name | [(3S,4Z,7S,8R,12R)-12-[(Z)-but-2-en-2-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,6-dioxo-5-trimethylsilyl-1-oxacyclododec-4-en-9-yn-7-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 138975803 |
| Molecular Formula | C30H50O6Si2 |
| Molecular Weight | 562.90 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | [(3S,4Z,7S,8R,12R)-12-[(Z)-but-2-en-2-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,6-dioxo-5-trimethylsilyl-1-oxacyclododec-4-en-9-yn-7-yl] 3-methylbutanoate |
| SMILES | C/C=C(/C)[C@H]1CC#C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(=O)CC(C)C)C(=O)/C([Si](C)(C)C)=C/[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C30H50O6Si2/c1-14-21(4)23-16-15-17-24(36-38(12,13)30(6,7)8)28(35-26(31)18-20(2)3)27(32)25(37(9,10)11)19-22(5)29(33)34-23/h14,19-20,22-24,28H,16,18H2,1-13H3/b21-14-,25-19-/t22-,23+,24+,28-/m0/s1 |
| InChIKey | RGWSJGUXYOHYDJ-CFJWORHMSA-N |
| XLogP | 6.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.90 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|