C22H40O4Si2 — CID 101115188
(4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]-2-(4-trimethylsilyloxybut-1-ynyl)cyclopent-2-en-1-one (PubChem CID 101115188) has the molecular formula C22H40O4Si2 and a molecular weight of 424.73 g/mol. Its IUPAC name is (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]-2-(4-trimethylsilyloxybut-1-ynyl)cyclopent-2-en-1-one.
| Compound Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]-2-(4-trimethylsilyloxybut-1-ynyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 101115188 |
| Molecular Formula | C22H40O4Si2 |
| Molecular Weight | 424.73 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]-2-(4-trimethylsilyloxybut-1-ynyl)cyclopent-2-en-1-one |
| SMILES | CC(C)(C)O[C@@H]1C=C(C#CCCO[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O4Si2/c1-21(2,3)25-18-16-17(14-12-13-15-24-27(7,8)9)19(23)20(18)26-28(10,11)22(4,5)6/h16,18,20H,13,15H2,1-11H3/t18-,20+/m1/s1 |
| InChIKey | HZVIKNVXZWCXMC-QUCCMNQESA-N |
| XLogP | 5.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.73 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|