C19H32O4Si — CID 101115189
(4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(4-hydroxybut-1-ynyl)-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one (PubChem CID 101115189) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(4-hydroxybut-1-ynyl)-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one.
| Compound Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(4-hydroxybut-1-ynyl)-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 101115189 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(4-hydroxybut-1-ynyl)-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one |
| SMILES | CC(C)(C)O[C@@H]1C=C(C#CCCO)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O4Si/c1-18(2,3)22-15-13-14(11-9-10-12-20)16(21)17(15)23-24(7,8)19(4,5)6/h13,15,17,20H,10,12H2,1-8H3/t15-,17+/m1/s1 |
| InChIKey | RIIGBBWLODGWQD-WBVHZDCISA-N |
| XLogP | 3.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|