C22H42O3Si3 — CID 10939069
(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-one (PubChem CID 10939069) has the molecular formula C22H42O3Si3 and a molecular weight of 438.83 g/mol. Its IUPAC name is (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-one.
| Compound Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10939069 |
| Molecular Formula | C22H42O3Si3 |
| Molecular Weight | 438.83 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)C(C#C[Si](C)(C)C)=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O3Si3/c1-21(2,3)27(10,11)24-18-16-17(14-15-26(7,8)9)19(23)20(18)25-28(12,13)22(4,5)6/h16,18,20H,1-13H3/t18-,20+/m1/s1 |
| InChIKey | KJLJMABAIUCENA-QUCCMNQESA-N |
| XLogP | 6.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.83 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|