C17H34O3Si2 — CID 11024337
(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopent-2-en-1-one (PubChem CID 11024337) has the molecular formula C17H34O3Si2 and a molecular weight of 342.63 g/mol. Its IUPAC name is (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopent-2-en-1-one.
| Compound Name | (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11024337 |
| Molecular Formula | C17H34O3Si2 |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=CC(=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si2/c1-16(2,3)21(7,8)19-14-12-11-13(18)15(14)20-22(9,10)17(4,5)6/h11-12,14-15H,1-10H3/t14-,15+/m0/s1 |
| InChIKey | LONYWOBFJFCEGF-LSDHHAIUSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|