C24H50O4Si3 — CID 11576727
(4R,5S,6R)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-one (PubChem CID 11576727) has the molecular formula C24H50O4Si3 and a molecular weight of 486.92 g/mol. Its IUPAC name is (4R,5S,6R)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-one.
| Compound Name | (4R,5S,6R)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11576727 |
| Molecular Formula | C24H50O4Si3 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (4R,5S,6R)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)C=CC(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O4Si3/c1-22(2,3)29(10,11)26-19-17-16-18(25)20(27-30(12,13)23(4,5)6)21(19)28-31(14,15)24(7,8)9/h16-17,19-21H,1-15H3/t19-,20+,21+/m1/s1 |
| InChIKey | ZJIKXZXCBBEGNT-HKBOAZHASA-N |
| XLogP | 7.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|