C18H35IO3Si2 — CID 138968444
(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclohex-2-en-1-one (PubChem CID 138968444) has the molecular formula C18H35IO3Si2 and a molecular weight of 482.55 g/mol. Its IUPAC name is (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclohex-2-en-1-one.
| Compound Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclohex-2-en-1-one |
|---|---|
| PubChem CID | 138968444 |
| Molecular Formula | C18H35IO3Si2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclohex-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)C(I)=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35IO3Si2/c1-17(2,3)23(7,8)21-15-11-13(19)14(20)12-16(15)22-24(9,10)18(4,5)6/h11,15-16H,12H2,1-10H3/t15-,16+/m1/s1 |
| InChIKey | XBKTYZYCWMPEKQ-CVEARBPZSA-N |
| XLogP | 6.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|