C19H34O4Si2 — CID 54095698
(4R)-2-(7-oxo-8-trimethylsilyloxyoct-2-enyl)-4-trimethylsilyloxycyclopent-2-en-1-one (PubChem CID 54095698) has the molecular formula C19H34O4Si2 and a molecular weight of 382.65 g/mol. Its IUPAC name is (4R)-2-(7-oxo-8-trimethylsilyloxyoct-2-enyl)-4-trimethylsilyloxycyclopent-2-en-1-one.
| Compound Name | (4R)-2-(7-oxo-8-trimethylsilyloxyoct-2-enyl)-4-trimethylsilyloxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 54095698 |
| Molecular Formula | C19H34O4Si2 |
| Molecular Weight | 382.65 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (4R)-2-(7-oxo-8-trimethylsilyloxyoct-2-enyl)-4-trimethylsilyloxycyclopent-2-en-1-one |
| SMILES | C[Si](C)(C)OCC(=O)CCCC=CCC1=C[C@H](O[Si](C)(C)C)CC1=O |
| InChI | InChI=1S/C19H34O4Si2/c1-24(2,3)22-15-17(20)12-10-8-7-9-11-16-13-18(14-19(16)21)23-25(4,5)6/h7,9,13,18H,8,10-12,14-15H2,1-6H3/t18-/m0/s1 |
| InChIKey | MWYKUTGKMACANY-SFHVURJKSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|