C22H44O4Si3 — CID 12770874
2-[(Z)-7,8-bis(trimethylsilyloxy)oct-2-enyl]-4-trimethylsilyloxycyclopent-2-en-1-one (PubChem CID 12770874) has the molecular formula C22H44O4Si3 and a molecular weight of 456.85 g/mol. Its IUPAC name is 2-[(Z)-7,8-bis(trimethylsilyloxy)oct-2-enyl]-4-trimethylsilyloxycyclopent-2-en-1-one.
| Compound Name | 2-[(Z)-7,8-bis(trimethylsilyloxy)oct-2-enyl]-4-trimethylsilyloxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 12770874 |
| Molecular Formula | C22H44O4Si3 |
| Molecular Weight | 456.85 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-[(Z)-7,8-bis(trimethylsilyloxy)oct-2-enyl]-4-trimethylsilyloxycyclopent-2-en-1-one |
| SMILES | C[Si](C)(C)OCC(CCC/C=C\CC1=CC(O[Si](C)(C)C)CC1=O)O[Si](C)(C)C |
| InChI | InChI=1S/C22H44O4Si3/c1-27(2,3)24-18-20(25-28(4,5)6)15-13-11-10-12-14-19-16-21(17-22(19)23)26-29(7,8)9/h10,12,16,20-21H,11,13-15,17-18H2,1-9H3/b12-10- |
| InChIKey | IYSCMPFLCLJJNU-BENRWUELSA-N |
| XLogP | 6.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.85 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|