About 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one
2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one (PubChem CID 12760713) has the molecular formula C22H46O4Si3
and a molecular weight of 458.86 g/mol. Its IUPAC name is 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one |
| PubChem CID | 12760713 |
| Molecular Formula | C22H46O4Si3 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one |
| SMILES | C[Si](C)(C)OCC(CCCCCCC1=CC(O[Si](C)(C)C)CC1=O)O[Si](C)(C)C |
| InChI | InChI=1S/C22H46O4Si3/c1-27(2,3)24-18-20(25-28(4,5)6)15-13-11-10-12-14-19-16-21(17-22(19)23)26-29(7,8)9/h16,20-21H,10-15,17-18H2,1-9H3 |
| InChIKey | KVZYNCCOIYWDGF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one?
The IUPAC name of 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one (CID 12760713) is 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one.
What is the SMILES notation for 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one?
The canonical SMILES for 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one is C[Si](C)(C)OCC(CCCCCCC1=CC(O[Si](C)(C)C)CC1=O)O[Si](C)(C)C.
What is the InChIKey of 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one?
The InChIKey is KVZYNCCOIYWDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46O4Si3/c1-27(2,3)24-18-20(25-28(4,5)6)15-13-11-10-12-14-19-16-21(17-22(19)23)26-29(7,8)9/h16,20-21H,10-15,17-18H2,1-9H3.
What are the key properties of 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one?
2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one has a molecular weight of 458.86 g/mol, XLogP of 6.52, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7,8-bis(trimethylsilyloxy)octyl]-4-trimethylsilyloxycyclopent-2-en-1-one is sourced from PubChem (CID 12760713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).